About 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one
3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one (PubChem CID 102362547) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one |
| PubChem CID | 102362547 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one |
| SMILES | C=CCCCCC(=[N+]=[N-])C1=CC(=O)C(C)(C)C1 |
| InChI | InChI=1S/C14H20N2O/c1-4-5-6-7-8-12(16-15)11-9-13(17)14(2,3)10-11/h4,9H,1,5-8,10H2,2-3H3 |
| InChIKey | JKSQONPVBPAQFI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one?
The IUPAC name of 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one (CID 102362547) is 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one.
What is the SMILES notation for 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one?
The canonical SMILES for 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one is C=CCCCCC(=[N+]=[N-])C1=CC(=O)C(C)(C)C1.
What is the InChIKey of 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one?
The InChIKey is JKSQONPVBPAQFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O/c1-4-5-6-7-8-12(16-15)11-9-13(17)14(2,3)10-11/h4,9H,1,5-8,10H2,2-3H3.
What are the key properties of 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one?
3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one has a molecular weight of 232.33 g/mol, XLogP of 3.33, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-diazohept-6-enyl)-5,5-dimethylcyclopent-2-en-1-one is sourced from PubChem (CID 102362547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).