C34H32Si2 — CID 102362865
trimethyl-[2-[16-(2-trimethylsilylethynyl)-4-pentacyclo[13.9.0.03,13.05,10.017,22]tetracosa-1(24),2,4,6,8,10,12,14,16,18,20,22-dodecaenyl]ethynyl]silane (PubChem CID 102362865) has the molecular formula C34H32Si2 and a molecular weight of 496.80 g/mol. Its IUPAC name is trimethyl-[2-[16-(2-trimethylsilylethynyl)-4-pentacyclo[13.9.0.03,13.05,10.017,22]tetracosa-1(24),2,4,6,8,10,12,14,16,18,20,22-dodecaenyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[16-(2-trimethylsilylethynyl)-4-pentacyclo[13.9.0.03,13.05,10.017,22]tetracosa-1(24),2,4,6,8,10,12,14,16,18,20,22-dodecaenyl]ethynyl]silane |
|---|---|
| PubChem CID | 102362865 |
| Molecular Formula | C34H32Si2 |
| Molecular Weight | 496.80 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | trimethyl-[2-[16-(2-trimethylsilylethynyl)-4-pentacyclo[13.9.0.03,13.05,10.017,22]tetracosa-1(24),2,4,6,8,10,12,14,16,18,20,22-dodecaenyl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#CC1=c2ccccc2=CC=c2cc3c(cc21)=CC=c1ccccc1=C3C#C[Si](C)(C)C |
| InChI | InChI=1S/C34H32Si2/c1-35(2,3)21-19-31-29-13-9-7-11-25(29)15-17-27-24-34-28(23-33(27)31)18-16-26-12-8-10-14-30(26)32(34)20-22-36(4,5)6/h7-18,23-24H,1-6H3 |
| InChIKey | ZWUAVDBRAJXSHY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.80 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|