C12H12O4 — CID 102363066
(4aS,9aR)-5-oxo-1,4a,6,7,8,9a-hexahydropyrano[3,4-b][1]benzofuran-3-carbaldehyde (PubChem CID 102363066) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is (4aS,9aR)-5-oxo-1,4a,6,7,8,9a-hexahydropyrano[3,4-b][1]benzofuran-3-carbaldehyde.
| Compound Name | (4aS,9aR)-5-oxo-1,4a,6,7,8,9a-hexahydropyrano[3,4-b][1]benzofuran-3-carbaldehyde |
|---|---|
| PubChem CID | 102363066 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (4aS,9aR)-5-oxo-1,4a,6,7,8,9a-hexahydropyrano[3,4-b][1]benzofuran-3-carbaldehyde |
| SMILES | O=CC1=C[C@H]2C3=C(CCCC3=O)O[C@H]2CO1 |
| InChI | InChI=1S/C12H12O4/c13-5-7-4-8-11(6-15-7)16-10-3-1-2-9(14)12(8)10/h4-5,8,11H,1-3,6H2/t8-,11+/m1/s1 |
| InChIKey | LYIVQOAVTYJPBO-KCJUWKMLSA-N |
| XLogP | 1.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|