About 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine
9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine (PubChem CID 102363107) has the molecular formula C16H12N2OS
and a molecular weight of 280.35 g/mol. Its IUPAC name is 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine.
Molecular Properties
| Compound Name | 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine |
| PubChem CID | 102363107 |
| Molecular Formula | C16H12N2OS |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine |
| SMILES | COc1ccc2c(c1)Sc1cc3ccccc3nc1N2 |
| InChI | InChI=1S/C16H12N2OS/c1-19-11-6-7-13-14(9-11)20-15-8-10-4-2-3-5-12(10)17-16(15)18-13/h2-9H,1H3,(H,17,18) |
| InChIKey | RKAAXMKQRYKLSL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine?
The IUPAC name of 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine (CID 102363107) is 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine.
What is the SMILES notation for 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine?
The canonical SMILES for 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine is COc1ccc2c(c1)Sc1cc3ccccc3nc1N2.
What is the InChIKey of 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine?
The InChIKey is RKAAXMKQRYKLSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2OS/c1-19-11-6-7-13-14(9-11)20-15-8-10-4-2-3-5-12(10)17-16(15)18-13/h2-9H,1H3,(H,17,18).
What are the key properties of 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine?
9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine has a molecular weight of 280.35 g/mol, XLogP of 4.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-6H-quinolino[3,2-b][1,4]benzothiazine is sourced from PubChem (CID 102363107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).