C19H31NO5Si — CID 102363440
(2S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide (PubChem CID 102363440) has the molecular formula C19H31NO5Si and a molecular weight of 381.55 g/mol. Its IUPAC name is (2S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide.
| Compound Name | (2S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide |
|---|---|
| PubChem CID | 102363440 |
| Molecular Formula | C19H31NO5Si |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | (2S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide |
| SMILES | CON(C)C(=O)[C@H]1O[C@@H](c2ccccc2)OC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H31NO5Si/c1-19(2,3)26(6,7)25-15-13-23-18(14-11-9-8-10-12-14)24-16(15)17(21)20(4)22-5/h8-12,15-16,18H,13H2,1-7H3/t15-,16+,18+/m1/s1 |
| InChIKey | JEKYAGYQWAOLBI-RYRKJORJSA-N |
| XLogP | 3.51 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|