About 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one
2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one (PubChem CID 102363750) has the molecular formula C18H18N2O3S
and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one.
Molecular Properties
| Compound Name | 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one |
| PubChem CID | 102363750 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)CCN=C2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N2O3S/c1-14-7-9-16(10-8-14)24(22,23)20-17(19-12-11-18(20)21)13-15-5-3-2-4-6-15/h2-10H,11-13H2,1H3 |
| InChIKey | GNNWQRNCGWGXTJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one?
The IUPAC name of 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one (CID 102363750) is 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one.
What is the SMILES notation for 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one?
The canonical SMILES for 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one is Cc1ccc(S(=O)(=O)N2C(=O)CCN=C2Cc2ccccc2)cc1.
What is the InChIKey of 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one?
The InChIKey is GNNWQRNCGWGXTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O3S/c1-14-7-9-16(10-8-14)24(22,23)20-17(19-12-11-18(20)21)13-15-5-3-2-4-6-15/h2-10H,11-13H2,1H3.
What are the key properties of 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one?
2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one has a molecular weight of 342.42 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one is sourced from PubChem (CID 102363750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).