C10H5F3N2O3 — CID 102364066
ethyl 4,5-dicyano-2-(trifluoromethyl)furan-3-carboxylate (PubChem CID 102364066) has the molecular formula C10H5F3N2O3 and a molecular weight of 258.15 g/mol. Its IUPAC name is ethyl 4,5-dicyano-2-(trifluoromethyl)furan-3-carboxylate.
| Compound Name | ethyl 4,5-dicyano-2-(trifluoromethyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 102364066 |
| Molecular Formula | C10H5F3N2O3 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | ethyl 4,5-dicyano-2-(trifluoromethyl)furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)F)oc(C#N)c1C#N |
| InChI | InChI=1S/C10H5F3N2O3/c1-2-17-9(16)7-5(3-14)6(4-15)18-8(7)10(11,12)13/h2H2,1H3 |
| InChIKey | QMMSDIFETJZUGG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 87.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |