C14H18O3 — CID 102364138
8,8-dimethyl-1,3,4,7,9,10a-hexahydropyrano[3,4-b]chromen-6-one (PubChem CID 102364138) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 8,8-dimethyl-1,3,4,7,9,10a-hexahydropyrano[3,4-b]chromen-6-one.
| Compound Name | 8,8-dimethyl-1,3,4,7,9,10a-hexahydropyrano[3,4-b]chromen-6-one |
|---|---|
| PubChem CID | 102364138 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 8,8-dimethyl-1,3,4,7,9,10a-hexahydropyrano[3,4-b]chromen-6-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1COCCC1=C2 |
| InChI | InChI=1S/C14H18O3/c1-14(2)6-11(15)10-5-9-3-4-16-8-13(9)17-12(10)7-14/h5,13H,3-4,6-8H2,1-2H3 |
| InChIKey | LEARQMBSBKXEDM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |