C15H19NO3S — CID 10236435
2-(1,1,3,3-tetramethyl-2-nitrososulfanylinden-2-yl)acetic acid (PubChem CID 10236435) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-(1,1,3,3-tetramethyl-2-nitrososulfanylinden-2-yl)acetic acid.
| Compound Name | 2-(1,1,3,3-tetramethyl-2-nitrososulfanylinden-2-yl)acetic acid |
|---|---|
| PubChem CID | 10236435 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-(1,1,3,3-tetramethyl-2-nitrososulfanylinden-2-yl)acetic acid |
| SMILES | CC1(C)c2ccccc2C(C)(C)C1(CC(=O)O)SN=O |
| InChI | InChI=1S/C15H19NO3S/c1-13(2)10-7-5-6-8-11(10)14(3,4)15(13,20-16-19)9-12(17)18/h5-8H,9H2,1-4H3,(H,17,18) |
| InChIKey | GRECBNBYNZDBHV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|