methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate

C15H12O5 — CID 102364536

IUPACmethyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate
SMILESCOC(=O)c1cc(O)c2c(c1)OC(c1ccccc1)O2
InChIInChI=1S/C15H12O5/c1-18-14(17)10-7-11(16)13-12(8-10)19-15(20-13)9-5-3-2-4-6-9/h2-8,15-16H,1H3
InChIKeyPLDQJDMALUSFHV-UHFFFAOYSA-N
MW272.26 g/mol
LogP2.65
Rot. Bonds2

About methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate

methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate (PubChem CID 102364536) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Namemethyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate
PubChem CID102364536
Molecular FormulaC15H12O5
Molecular Weight272.26 g/mol
Exact Mass272.07
IUPAC Namemethyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate
SMILESCOC(=O)c1cc(O)c2c(c1)OC(c1ccccc1)O2
InChIInChI=1S/C15H12O5/c1-18-14(17)10-7-11(16)13-12(8-10)19-15(20-13)9-5-3-2-4-6-9/h2-8,15-16H,1H3
InChIKeyPLDQJDMALUSFHV-UHFFFAOYSA-N
XLogP2.65
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.26
LogP ≤ 52.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate?
The IUPAC name of methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate (CID 102364536) is methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate?
The canonical SMILES for methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate is COC(=O)c1cc(O)c2c(c1)OC(c1ccccc1)O2.
What is the InChIKey of methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate?
The InChIKey is PLDQJDMALUSFHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O5/c1-18-14(17)10-7-11(16)13-12(8-10)19-15(20-13)9-5-3-2-4-6-9/h2-8,15-16H,1H3.
What are the key properties of methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate?
methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate has a molecular weight of 272.26 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 102364536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).