C15H12O5 — CID 102364536
methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate (PubChem CID 102364536) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 102364536 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | methyl 7-hydroxy-2-phenyl-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)c1cc(O)c2c(c1)OC(c1ccccc1)O2 |
| InChI | InChI=1S/C15H12O5/c1-18-14(17)10-7-11(16)13-12(8-10)19-15(20-13)9-5-3-2-4-6-9/h2-8,15-16H,1H3 |
| InChIKey | PLDQJDMALUSFHV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |