C19H20O3 — CID 10236457
3,3-dimethyl-6-[1-(4-phenylphenyl)ethenyl]-1,2,4-trioxane (PubChem CID 10236457) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3,3-dimethyl-6-[1-(4-phenylphenyl)ethenyl]-1,2,4-trioxane.
| Compound Name | 3,3-dimethyl-6-[1-(4-phenylphenyl)ethenyl]-1,2,4-trioxane |
|---|---|
| PubChem CID | 10236457 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 3,3-dimethyl-6-[1-(4-phenylphenyl)ethenyl]-1,2,4-trioxane |
| SMILES | C=C(c1ccc(-c2ccccc2)cc1)C1COC(C)(C)OO1 |
| InChI | InChI=1S/C19H20O3/c1-14(18-13-20-19(2,3)22-21-18)15-9-11-17(12-10-15)16-7-5-4-6-8-16/h4-12,18H,1,13H2,2-3H3 |
| InChIKey | JSTMVUSMVCDADJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|