About 5-chloro-3-ethyl-1,3-dimethylindol-2-one
5-chloro-3-ethyl-1,3-dimethylindol-2-one (PubChem CID 102364594) has the molecular formula C12H14ClNO
and a molecular weight of 223.70 g/mol. Its IUPAC name is 5-chloro-3-ethyl-1,3-dimethylindol-2-one.
Molecular Properties
| Compound Name | 5-chloro-3-ethyl-1,3-dimethylindol-2-one |
| PubChem CID | 102364594 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 5-chloro-3-ethyl-1,3-dimethylindol-2-one |
| SMILES | CCC1(C)C(=O)N(C)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H14ClNO/c1-4-12(2)9-7-8(13)5-6-10(9)14(3)11(12)15/h5-7H,4H2,1-3H3 |
| InChIKey | JQKQTAKYKPDJIM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-3-ethyl-1,3-dimethylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-ethyl-1,3-dimethylindol-2-one?
The IUPAC name of 5-chloro-3-ethyl-1,3-dimethylindol-2-one (CID 102364594) is 5-chloro-3-ethyl-1,3-dimethylindol-2-one.
What is the SMILES notation for 5-chloro-3-ethyl-1,3-dimethylindol-2-one?
The canonical SMILES for 5-chloro-3-ethyl-1,3-dimethylindol-2-one is CCC1(C)C(=O)N(C)c2ccc(Cl)cc21.
What is the InChIKey of 5-chloro-3-ethyl-1,3-dimethylindol-2-one?
The InChIKey is JQKQTAKYKPDJIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO/c1-4-12(2)9-7-8(13)5-6-10(9)14(3)11(12)15/h5-7H,4H2,1-3H3.
What are the key properties of 5-chloro-3-ethyl-1,3-dimethylindol-2-one?
5-chloro-3-ethyl-1,3-dimethylindol-2-one has a molecular weight of 223.70 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-ethyl-1,3-dimethylindol-2-one is sourced from PubChem (CID 102364594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).