About 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane
3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane (PubChem CID 10236463) has the molecular formula C9H20IN3
and a molecular weight of 297.18 g/mol. Its IUPAC name is 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane.
Molecular Properties
| Compound Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane |
| PubChem CID | 10236463 |
| Molecular Formula | C9H20IN3 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane |
| SMILES | CCN=C=NCCCN(C)C.CI |
| InChI | InChI=1S/C8H17N3.CH3I/c1-4-9-8-10-6-5-7-11(2)3;1-2/h4-7H2,1-3H3;1H3 |
| InChIKey | ASYVZGDYOMRIPZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane?
The IUPAC name of 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane (CID 10236463) is 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane.
What is the SMILES notation for 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane?
The canonical SMILES for 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane is CCN=C=NCCCN(C)C.CI.
What is the InChIKey of 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane?
The InChIKey is ASYVZGDYOMRIPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3.CH3I/c1-4-9-8-10-6-5-7-11(2)3;1-2/h4-7H2,1-3H3;1H3.
What are the key properties of 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane?
3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane has a molecular weight of 297.18 g/mol, XLogP of 2.18, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane is sourced from PubChem (CID 10236463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).