C40H52O8 — CID 102365481
(4R,7R)-4-(5,5-dimethyl-4-oxofuran-2-yl)-2,2-dimethyl-4,7-bis[(E)-3-methyl-5-[(2S)-4-methyl-6-oxo-2,3-dihydropyran-2-yl]pent-4-enyl]-6,7-dihydro-5H-1-benzofuran-3-one (PubChem CID 102365481) has the molecular formula C40H52O8 and a molecular weight of 660.85 g/mol. Its IUPAC name is (4R,7R)-4-(5,5-dimethyl-4-oxofuran-2-yl)-2,2-dimethyl-4,7-bis[(E)-3-methyl-5-[(2S)-4-methyl-6-oxo-2,3-dihydropyran-2-yl]pent-4-enyl]-6,7-dihydro-5H-1-benzofuran-3-one.
| Compound Name | (4R,7R)-4-(5,5-dimethyl-4-oxofuran-2-yl)-2,2-dimethyl-4,7-bis[(E)-3-methyl-5-[(2S)-4-methyl-6-oxo-2,3-dihydropyran-2-yl]pent-4-enyl]-6,7-dihydro-5H-1-benzofuran-3-one |
|---|---|
| PubChem CID | 102365481 |
| Molecular Formula | C40H52O8 |
| Molecular Weight | 660.85 g/mol |
| Exact Mass | 660.37 |
| IUPAC Name | (4R,7R)-4-(5,5-dimethyl-4-oxofuran-2-yl)-2,2-dimethyl-4,7-bis[(E)-3-methyl-5-[(2S)-4-methyl-6-oxo-2,3-dihydropyran-2-yl]pent-4-enyl]-6,7-dihydro-5H-1-benzofuran-3-one |
| SMILES | CC1=CC(=O)O[C@H](/C=C/C(C)CC[C@@H]2CC[C@@](CCC(C)/C=C/[C@@H]3CC(C)=CC(=O)O3)(C3=CC(=O)C(C)(C)O3)C3=C2OC(C)(C)C3=O)C1 |
| InChI | InChI=1S/C40H52O8/c1-24(10-13-29-19-26(3)21-33(42)45-29)9-12-28-16-18-40(32-23-31(41)38(5,6)47-32,35-36(28)48-39(7,8)37(35)44)17-15-25(2)11-14-30-20-27(4)22-34(43)46-30/h10-11,13-14,21-25,28-30H,9,12,15-20H2,1-8H3/b13-10+,14-11+/t24?,25?,28-,29-,30-,40+/m1/s1 |
| InChIKey | RAYWYMXOTSVLKD-AZKOILSESA-N |
| XLogP | 7.75 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.85 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|