C15H16BrNO6 — CID 102365596
dimethyl 2-[(E,2S)-4-(4-bromophenyl)-1-nitrobut-3-en-2-yl]propanedioate (PubChem CID 102365596) has the molecular formula C15H16BrNO6 and a molecular weight of 386.20 g/mol. Its IUPAC name is dimethyl 2-[(E,2S)-4-(4-bromophenyl)-1-nitrobut-3-en-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(E,2S)-4-(4-bromophenyl)-1-nitrobut-3-en-2-yl]propanedioate |
|---|---|
| PubChem CID | 102365596 |
| Molecular Formula | C15H16BrNO6 |
| Molecular Weight | 386.20 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | dimethyl 2-[(E,2S)-4-(4-bromophenyl)-1-nitrobut-3-en-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](/C=C/c1ccc(Br)cc1)C[N+](=O)[O-] |
| InChI | InChI=1S/C15H16BrNO6/c1-22-14(18)13(15(19)23-2)11(9-17(20)21)6-3-10-4-7-12(16)8-5-10/h3-8,11,13H,9H2,1-2H3/b6-3+/t11-/m1/s1 |
| InChIKey | KAEVDFIUTSXROZ-ZXCPCRMDSA-N |
| XLogP | 2.32 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|