C27H36N2O4 — CID 102365706
(4-acetamidophenyl) (2S,3S)-3-methyl-2-[[(2R)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]pentanoate (PubChem CID 102365706) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is (4-acetamidophenyl) (2S,3S)-3-methyl-2-[[(2R)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]pentanoate.
| Compound Name | (4-acetamidophenyl) (2S,3S)-3-methyl-2-[[(2R)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 102365706 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | (4-acetamidophenyl) (2S,3S)-3-methyl-2-[[(2R)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]pentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](C)c1ccc(CC(C)C)cc1)C(=O)Oc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C27H36N2O4/c1-7-18(4)25(27(32)33-24-14-12-23(13-15-24)28-20(6)30)29-26(31)19(5)22-10-8-21(9-11-22)16-17(2)3/h8-15,17-19,25H,7,16H2,1-6H3,(H,28,30)(H,29,31)/t18-,19+,25-/m0/s1 |
| InChIKey | IIEOQXHSAFEQHW-CEYNDMKZSA-N |
| XLogP | 5.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|