C22H38O4Si — CID 102366182
(3aS,5aR,6R,9aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a-dimethyl-2-oxo-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-6-carbaldehyde (PubChem CID 102366182) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is (3aS,5aR,6R,9aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a-dimethyl-2-oxo-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-6-carbaldehyde.
| Compound Name | (3aS,5aR,6R,9aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a-dimethyl-2-oxo-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-6-carbaldehyde |
|---|---|
| PubChem CID | 102366182 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (3aS,5aR,6R,9aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a-dimethyl-2-oxo-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-6-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]12CC[C@H]3[C@](C)(C=O)CCC[C@]3(C)C1CC(=O)O2 |
| InChI | InChI=1S/C22H38O4Si/c1-19(2,3)27(6,7)25-15-22-12-9-16-20(4,14-23)10-8-11-21(16,5)17(22)13-18(24)26-22/h14,16-17H,8-13,15H2,1-7H3/t16-,17?,20-,21-,22+/m0/s1 |
| InChIKey | SGASFWUYDMXCRE-KBAKZFMASA-N |
| XLogP | 5.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|