C21H36O4Si — CID 102366184
(3aS,5aS,6R,9aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-9a-methyl-2-oxo-4,5,5a,6,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-6-carbaldehyde (PubChem CID 102366184) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (3aS,5aS,6R,9aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-9a-methyl-2-oxo-4,5,5a,6,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-6-carbaldehyde.
| Compound Name | (3aS,5aS,6R,9aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-9a-methyl-2-oxo-4,5,5a,6,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-6-carbaldehyde |
|---|---|
| PubChem CID | 102366184 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (3aS,5aS,6R,9aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-9a-methyl-2-oxo-4,5,5a,6,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-6-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]12CC[C@H]3[C@H](C=O)CCC[C@]3(C)C1CC(=O)O2 |
| InChI | InChI=1S/C21H36O4Si/c1-19(2,3)26(5,6)24-14-21-11-9-16-15(13-22)8-7-10-20(16,4)17(21)12-18(23)25-21/h13,15-17H,7-12,14H2,1-6H3/t15-,16-,17?,20-,21+/m0/s1 |
| InChIKey | SMXKYUBJDCYMRR-WIKJJEKGSA-N |
| XLogP | 4.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|