About 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one
5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one (PubChem CID 10236655) has the molecular formula C11H7BrF2N2O2
and a molecular weight of 317.09 g/mol. Its IUPAC name is 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one |
| PubChem CID | 10236655 |
| Molecular Formula | C11H7BrF2N2O2 |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(OCc2ccc(F)cc2F)c1Br |
| InChI | InChI=1S/C11H7BrF2N2O2/c12-10-9(4-15-16-11(10)17)18-5-6-1-2-7(13)3-8(6)14/h1-4H,5H2,(H,16,17) |
| InChIKey | LPQSHJAUFHNBBI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one?
The IUPAC name of 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one (CID 10236655) is 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one.
What is the SMILES notation for 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one?
The canonical SMILES for 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one is O=c1[nH]ncc(OCc2ccc(F)cc2F)c1Br.
What is the InChIKey of 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one?
The InChIKey is LPQSHJAUFHNBBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrF2N2O2/c12-10-9(4-15-16-11(10)17)18-5-6-1-2-7(13)3-8(6)14/h1-4H,5H2,(H,16,17).
What are the key properties of 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one?
5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one has a molecular weight of 317.09 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-[(2,4-difluorophenyl)methoxy]-1H-pyridazin-6-one is sourced from PubChem (CID 10236655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).