About N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide
N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide (PubChem CID 102366665) has the molecular formula C12H18FNO
and a molecular weight of 211.28 g/mol. Its IUPAC name is N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide.
Molecular Properties
| Compound Name | N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide |
| PubChem CID | 102366665 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide |
| SMILES | CC(=O)NC12C[C@@H]3C[C@@H](CC(F)(C3)C1)C2 |
| InChI | InChI=1S/C12H18FNO/c1-8(15)14-12-5-9-2-10(6-12)4-11(13,3-9)7-12/h9-10H,2-7H2,1H3,(H,14,15)/t9-,10+,11?,12? |
| InChIKey | FGICIOIKPNUROT-ZYANWLCNSA-N |
| XLogP | 2.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide?
The IUPAC name of N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide (CID 102366665) is N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide.
What is the SMILES notation for N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide?
The canonical SMILES for N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide is CC(=O)NC12C[C@@H]3C[C@@H](CC(F)(C3)C1)C2.
What is the InChIKey of N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide?
The InChIKey is FGICIOIKPNUROT-ZYANWLCNSA-N. The full InChI is InChI=1S/C12H18FNO/c1-8(15)14-12-5-9-2-10(6-12)4-11(13,3-9)7-12/h9-10H,2-7H2,1H3,(H,14,15)/t9-,10+,11?,12?.
What are the key properties of N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide?
N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide has a molecular weight of 211.28 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5S,7R)-3-fluoro-1-adamantyl]acetamide is sourced from PubChem (CID 102366665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).