C42H34N12O8 — CID 102366898
2-azidoethyl 4-[2,4,5-tris[4-(2-azidoethoxycarbonyl)phenyl]phenyl]benzoate (PubChem CID 102366898) has the molecular formula C42H34N12O8 and a molecular weight of 834.81 g/mol. Its IUPAC name is 2-azidoethyl 4-[2,4,5-tris[4-(2-azidoethoxycarbonyl)phenyl]phenyl]benzoate.
| Compound Name | 2-azidoethyl 4-[2,4,5-tris[4-(2-azidoethoxycarbonyl)phenyl]phenyl]benzoate |
|---|---|
| PubChem CID | 102366898 |
| Molecular Formula | C42H34N12O8 |
| Molecular Weight | 834.81 g/mol |
| Exact Mass | 834.26 |
| IUPAC Name | 2-azidoethyl 4-[2,4,5-tris[4-(2-azidoethoxycarbonyl)phenyl]phenyl]benzoate |
| SMILES | [N-]=[N+]=NCCOC(=O)c1ccc(-c2cc(-c3ccc(C(=O)OCCN=[N+]=[N-])cc3)c(-c3ccc(C(=O)OCCN=[N+]=[N-])cc3)cc2-c2ccc(C(=O)OCCN=[N+]=[N-])cc2)cc1 |
| InChI | InChI=1S/C42H34N12O8/c43-51-47-17-21-59-39(55)31-9-1-27(2-10-31)35-25-37(29-5-13-33(14-6-29)41(57)61-23-19-49-53-45)38(30-7-15-34(16-8-30)42(58)62-24-20-50-54-46)26-36(35)28-3-11-32(12-4-28)40(56)60-22-18-48-52-44/h1-16,25-26H,17-24H2 |
| InChIKey | HAHDKFNNLNQGCT-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 300.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.81 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|