About 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine
2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine (PubChem CID 102367352) has the molecular formula C30H20F2N6
and a molecular weight of 502.53 g/mol. Its IUPAC name is 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine |
| PubChem CID | 102367352 |
| Molecular Formula | C30H20F2N6 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine |
| SMILES | FC(c1ccccn1)(c1ccccn1)c1ccc2ccc(C(F)(c3ccccn3)c3ccccn3)nc2n1 |
| InChI | InChI=1S/C30H20F2N6/c31-29(22-9-1-5-17-33-22,23-10-2-6-18-34-23)26-15-13-21-14-16-27(38-28(21)37-26)30(32,24-11-3-7-19-35-24)25-12-4-8-20-36-25/h1-20H |
| InChIKey | HXGPBZKGPPZSGX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine?
The IUPAC name of 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine (CID 102367352) is 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine.
What is the SMILES notation for 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine?
The canonical SMILES for 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine is FC(c1ccccn1)(c1ccccn1)c1ccc2ccc(C(F)(c3ccccn3)c3ccccn3)nc2n1.
What is the InChIKey of 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine?
The InChIKey is HXGPBZKGPPZSGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H20F2N6/c31-29(22-9-1-5-17-33-22,23-10-2-6-18-34-23)26-15-13-21-14-16-27(38-28(21)37-26)30(32,24-11-3-7-19-35-24)25-12-4-8-20-36-25/h1-20H.
What are the key properties of 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine?
2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine has a molecular weight of 502.53 g/mol, XLogP of 5.73, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine is sourced from PubChem (CID 102367352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).