C17H13FN2O2S — CID 10236752
6-(4-fluorophenyl)-1-(4-methylsulfanylphenyl)pyrimidine-2,4-dione (PubChem CID 10236752) has the molecular formula C17H13FN2O2S and a molecular weight of 328.37 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1-(4-methylsulfanylphenyl)pyrimidine-2,4-dione.
| Compound Name | 6-(4-fluorophenyl)-1-(4-methylsulfanylphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10236752 |
| Molecular Formula | C17H13FN2O2S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 6-(4-fluorophenyl)-1-(4-methylsulfanylphenyl)pyrimidine-2,4-dione |
| SMILES | CSc1ccc(-n2c(-c3ccc(F)cc3)cc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H13FN2O2S/c1-23-14-8-6-13(7-9-14)20-15(10-16(21)19-17(20)22)11-2-4-12(18)5-3-11/h2-10H,1H3,(H,19,21,22) |
| InChIKey | MBHQFRGEQXLNRI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |