C25H43NO5SSi2 — CID 102367798
(1R,2R,8S)-7-(benzenesulfinyl)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 102367798) has the molecular formula C25H43NO5SSi2 and a molecular weight of 525.86 g/mol. Its IUPAC name is (1R,2R,8S)-7-(benzenesulfinyl)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (1R,2R,8S)-7-(benzenesulfinyl)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 102367798 |
| Molecular Formula | C25H43NO5SSi2 |
| Molecular Weight | 525.86 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | (1R,2R,8S)-7-(benzenesulfinyl)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N2CCC(S(=O)c3ccccc3)[C@@]12O |
| InChI | InChI=1S/C25H43NO5SSi2/c1-23(2,3)33(7,8)30-20-21(31-34(9,10)24(4,5)6)25(28)19(16-17-26(25)22(20)27)32(29)18-14-12-11-13-15-18/h11-15,19-21,28H,16-17H2,1-10H3/t19?,20-,21-,25-,32?/m1/s1 |
| InChIKey | ILJUJBFJLRBNPU-VUHQMGKCSA-N |
| XLogP | 4.88 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.86 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|