C20H24O5 — CID 10236901
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(3-methylphenyl)methyl]phenyl]oxane-3,4,5-triol (PubChem CID 10236901) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(3-methylphenyl)methyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(3-methylphenyl)methyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10236901 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(3-methylphenyl)methyl]phenyl]oxane-3,4,5-triol |
| SMILES | Cc1cccc(Cc2cccc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)c1 |
| InChI | InChI=1S/C20H24O5/c1-12-4-2-5-13(8-12)9-14-6-3-7-15(10-14)20-19(24)18(23)17(22)16(11-21)25-20/h2-8,10,16-24H,9,11H2,1H3/t16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | GMIUHEOBZYBBHN-OBKDMQGPSA-N |
| XLogP | 1.10 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |