About 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine
6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 10236989) has the molecular formula C17H13N5S2
and a molecular weight of 351.46 g/mol. Its IUPAC name is 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 10236989 |
| Molecular Formula | C17H13N5S2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | C(=N/Nc1ncnc2sc(Cc3ccccc3)cc12)\c1nccs1 |
| InChI | InChI=1S/C17H13N5S2/c1-2-4-12(5-3-1)8-13-9-14-16(19-11-20-17(14)24-13)22-21-10-15-18-6-7-23-15/h1-7,9-11H,8H2,(H,19,20,22)/b21-10+ |
| InChIKey | COWYHWTUQODVNE-UFFVCSGVSA-N |
| XLogP | 4.18 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine (CID 10236989) is 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine is C(=N/Nc1ncnc2sc(Cc3ccccc3)cc12)\c1nccs1.
What is the InChIKey of 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is COWYHWTUQODVNE-UFFVCSGVSA-N. The full InChI is InChI=1S/C17H13N5S2/c1-2-4-12(5-3-1)8-13-9-14-16(19-11-20-17(14)24-13)22-21-10-15-18-6-7-23-15/h1-7,9-11H,8H2,(H,19,20,22)/b21-10+.
What are the key properties of 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine?
6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 351.46 g/mol, XLogP of 4.18, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 10236989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).