C20H29NO6 — CID 102370620
tert-butyl N-[[(3aR,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-phenylmethyl]carbamate (PubChem CID 102370620) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is tert-butyl N-[[(3aR,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-phenylmethyl]carbamate.
| Compound Name | tert-butyl N-[[(3aR,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 102370620 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | tert-butyl N-[[(3aR,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-phenylmethyl]carbamate |
| SMILES | COC1O[C@H](C(NC(=O)OC(C)(C)C)c2ccccc2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C20H29NO6/c1-19(2,3)27-18(22)21-13(12-10-8-7-9-11-12)14-15-16(17(23-6)24-14)26-20(4,5)25-15/h7-11,13-17H,1-6H3,(H,21,22)/t13?,14-,15-,16-,17?/m1/s1 |
| InChIKey | MXPDGMRBAROKFQ-CUQMJCILSA-N |
| XLogP | 3.14 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |