C16H29ClO5S2 — CID 102370647
[(1R,2R,4S,5S,6S,8S)-5-(chloromethylsulfinyloxy)-2,6-dimethyl-8-propan-2-yl-2-bicyclo[2.2.2]octanyl]methyl methanesulfonate (PubChem CID 102370647) has the molecular formula C16H29ClO5S2 and a molecular weight of 400.99 g/mol. Its IUPAC name is [(1R,2R,4S,5S,6S,8S)-5-(chloromethylsulfinyloxy)-2,6-dimethyl-8-propan-2-yl-2-bicyclo[2.2.2]octanyl]methyl methanesulfonate.
| Compound Name | [(1R,2R,4S,5S,6S,8S)-5-(chloromethylsulfinyloxy)-2,6-dimethyl-8-propan-2-yl-2-bicyclo[2.2.2]octanyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 102370647 |
| Molecular Formula | C16H29ClO5S2 |
| Molecular Weight | 400.99 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [(1R,2R,4S,5S,6S,8S)-5-(chloromethylsulfinyloxy)-2,6-dimethyl-8-propan-2-yl-2-bicyclo[2.2.2]octanyl]methyl methanesulfonate |
| SMILES | CC(C)[C@@H]1C[C@@H]2[C@H](C)[C@H](OS(=O)CCl)[C@H]1C[C@@]2(C)COS(C)(=O)=O |
| InChI | InChI=1S/C16H29ClO5S2/c1-10(2)12-6-14-11(3)15(22-23(18)9-17)13(12)7-16(14,4)8-21-24(5,19)20/h10-15H,6-9H2,1-5H3/t11-,12-,13-,14+,15-,16-,23?/m0/s1 |
| InChIKey | QGAKBWVMXNRYAY-BRBRFBNJSA-N |
| XLogP | 3.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.99 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|