About 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan
4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan (PubChem CID 102371046) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan.
Molecular Properties
| Compound Name | 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan |
| PubChem CID | 102371046 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan |
| SMILES | C=CCC1=C(CCCC)C(C)(C)OC1 |
| InChI | InChI=1S/C13H22O/c1-5-7-9-12-11(8-6-2)10-14-13(12,3)4/h6H,2,5,7-10H2,1,3-4H3 |
| InChIKey | LVJAONXCINWPHR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan?
The IUPAC name of 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan (CID 102371046) is 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan.
What is the SMILES notation for 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan?
The canonical SMILES for 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan is C=CCC1=C(CCCC)C(C)(C)OC1.
What is the InChIKey of 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan?
The InChIKey is LVJAONXCINWPHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O/c1-5-7-9-12-11(8-6-2)10-14-13(12,3)4/h6H,2,5,7-10H2,1,3-4H3.
What are the key properties of 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan?
4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan has a molecular weight of 194.32 g/mol, XLogP of 3.86, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-5,5-dimethyl-3-prop-2-enyl-2H-furan is sourced from PubChem (CID 102371046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).