About [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane
[(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane (PubChem CID 102372395) has the molecular formula C23H26O2Si
and a molecular weight of 362.55 g/mol. Its IUPAC name is [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane.
Molecular Properties
| Compound Name | [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane |
| PubChem CID | 102372395 |
| Molecular Formula | C23H26O2Si |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane |
| SMILES | C[Si](O[C@@H]1CCCC[C@H]1c1ccco1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26O2Si/c1-26(19-11-4-2-5-12-19,20-13-6-3-7-14-20)25-23-16-9-8-15-21(23)22-17-10-18-24-22/h2-7,10-14,17-18,21,23H,8-9,15-16H2,1H3/t21-,23+/m0/s1 |
| InChIKey | QTUQIMGRKDXKLE-JTHBVZDNSA-N |
| XLogP | 4.71 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane?
The IUPAC name of [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane (CID 102372395) is [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane.
What is the SMILES notation for [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane?
The canonical SMILES for [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane is C[Si](O[C@@H]1CCCC[C@H]1c1ccco1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane?
The InChIKey is QTUQIMGRKDXKLE-JTHBVZDNSA-N. The full InChI is InChI=1S/C23H26O2Si/c1-26(19-11-4-2-5-12-19,20-13-6-3-7-14-20)25-23-16-9-8-15-21(23)22-17-10-18-24-22/h2-7,10-14,17-18,21,23H,8-9,15-16H2,1H3/t21-,23+/m0/s1.
What are the key properties of [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane?
[(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane has a molecular weight of 362.55 g/mol, XLogP of 4.71, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-(furan-2-yl)cyclohexyl]oxy-methyl-diphenylsilane is sourced from PubChem (CID 102372395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).