C21H30N2O4 — CID 102372502
methyl (1S,8S)-1-amino-8-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4,5,6,7,8-hexahydro-2H-anthracene-1-carboxylate (PubChem CID 102372502) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is methyl (1S,8S)-1-amino-8-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4,5,6,7,8-hexahydro-2H-anthracene-1-carboxylate.
| Compound Name | methyl (1S,8S)-1-amino-8-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4,5,6,7,8-hexahydro-2H-anthracene-1-carboxylate |
|---|---|
| PubChem CID | 102372502 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | methyl (1S,8S)-1-amino-8-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4,5,6,7,8-hexahydro-2H-anthracene-1-carboxylate |
| SMILES | COC(=O)[C@]1(N)CCCc2cc3c(cc21)[C@@H](NC(=O)OC(C)(C)C)CCC3 |
| InChI | InChI=1S/C21H30N2O4/c1-20(2,3)27-19(25)23-17-9-5-7-13-11-14-8-6-10-21(22,18(24)26-4)16(14)12-15(13)17/h11-12,17H,5-10,22H2,1-4H3,(H,23,25)/t17-,21-/m0/s1 |
| InChIKey | ACBBWWUPPDRUCY-UWJYYQICSA-N |
| XLogP | 3.25 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |