C20H33NOSSe — CID 102372561
N-[(1S,2S)-2-[[(1S,2S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]selanyl]cyclooctyl]ethanethioamide (PubChem CID 102372561) has the molecular formula C20H33NOSSe and a molecular weight of 414.52 g/mol. Its IUPAC name is N-[(1S,2S)-2-[[(1S,2S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]selanyl]cyclooctyl]ethanethioamide.
| Compound Name | N-[(1S,2S)-2-[[(1S,2S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]selanyl]cyclooctyl]ethanethioamide |
|---|---|
| PubChem CID | 102372561 |
| Molecular Formula | C20H33NOSSe |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[(1S,2S)-2-[[(1S,2S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]selanyl]cyclooctyl]ethanethioamide |
| SMILES | CC(=S)N[C@H]1CCCCCC[C@@H]1[Se][C@@H]1C(=O)[C@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C20H33NOSSe/c1-13(23)21-15-9-7-5-6-8-10-16(15)24-17-14-11-12-20(4,18(17)22)19(14,2)3/h14-17H,5-12H2,1-4H3,(H,21,23)/t14-,15+,16+,17+,20+/m1/s1 |
| InChIKey | KTUTXAFBBVURIF-WDHIOAMHSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|