C25H24O3 — CID 10237257
2-[4-[2-(8-ethynyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]phenyl]acetic acid (PubChem CID 10237257) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is 2-[4-[2-(8-ethynyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]phenyl]acetic acid.
| Compound Name | 2-[4-[2-(8-ethynyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 10237257 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[4-[2-(8-ethynyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]phenyl]acetic acid |
| SMILES | C#Cc1cc(C#Cc2ccc(CC(=O)O)cc2)cc2c1OC(C)(C)CC2(C)C |
| InChI | InChI=1S/C25H24O3/c1-6-20-13-19(12-9-17-7-10-18(11-8-17)15-22(26)27)14-21-23(20)28-25(4,5)16-24(21,2)3/h1,7-8,10-11,13-14H,15-16H2,2-5H3,(H,26,27) |
| InChIKey | AOIWWOZOUNRXHK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|