C22H18N6O2 — CID 1023730
3-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]benzoic acid (PubChem CID 1023730) has the molecular formula C22H18N6O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 3-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]benzoic acid.
| Compound Name | 3-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 1023730 |
| Molecular Formula | C22H18N6O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 3-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H18N6O2/c29-19(30)15-8-7-13-18(14-15)25-22-27-20(23-16-9-3-1-4-10-16)26-21(28-22)24-17-11-5-2-6-12-17/h1-14H,(H,29,30)(H3,23,24,25,26,27,28) |
| InChIKey | QLINFGQSAXACLV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |