C29H36N6O6S — CID 102373199
2-[2-[2-[4-[[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]diazenyl]-N-methylanilino]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 102373199) has the molecular formula C29H36N6O6S and a molecular weight of 596.71 g/mol. Its IUPAC name is 2-[2-[2-[4-[[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]diazenyl]-N-methylanilino]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[4-[[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]diazenyl]-N-methylanilino]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102373199 |
| Molecular Formula | C29H36N6O6S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | 2-[2-[2-[4-[[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]diazenyl]-N-methylanilino]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOCCN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)Nc3cc(C)nc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C29H36N6O6S/c1-21(2)29(36)41-19-18-40-17-16-39-15-14-35(5)26-10-6-24(7-11-26)32-33-25-8-12-27(13-9-25)42(37,38)34-28-20-22(3)30-23(4)31-28/h6-13,20H,1,14-19H2,2-5H3,(H,30,31,34)/b33-32+ |
| InChIKey | IASWCWQKSUJDGD-ULIFNZDWSA-N |
| XLogP | 4.90 |
| TPSA | 144.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|