C31H43NOS — CID 102373378
5-(5-heptylthiophen-2-yl)-3-[4-(4-pentylcyclohexyl)phenyl]-1,2-oxazole (PubChem CID 102373378) has the molecular formula C31H43NOS and a molecular weight of 477.76 g/mol. Its IUPAC name is 5-(5-heptylthiophen-2-yl)-3-[4-(4-pentylcyclohexyl)phenyl]-1,2-oxazole.
| Compound Name | 5-(5-heptylthiophen-2-yl)-3-[4-(4-pentylcyclohexyl)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 102373378 |
| Molecular Formula | C31H43NOS |
| Molecular Weight | 477.76 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 5-(5-heptylthiophen-2-yl)-3-[4-(4-pentylcyclohexyl)phenyl]-1,2-oxazole |
| SMILES | CCCCCCCc1ccc(-c2cc(-c3ccc(C4CCC(CCCCC)CC4)cc3)no2)s1 |
| InChI | InChI=1S/C31H43NOS/c1-3-5-7-8-10-12-28-21-22-31(34-28)30-23-29(32-33-30)27-19-17-26(18-20-27)25-15-13-24(14-16-25)11-9-6-4-2/h17-25H,3-16H2,1-2H3 |
| InChIKey | KPGCTPMMMFWAFZ-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.76 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|