About trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one
trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one (PubChem CID 102373494) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one |
| PubChem CID | 102373494 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one |
| SMILES | C=CC[C@@H]1CCC[C@@](O)(CC=C)C1=O |
| InChI | InChI=1S/C12H18O2/c1-3-6-10-7-5-9-12(14,8-4-2)11(10)13/h3-4,10,14H,1-2,5-9H2/t10-,12+/m1/s1 |
| InChIKey | LCWXKYZWXFBBIT-PWSUYJOCSA-N |
| XLogP | 2.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one?
The IUPAC name of trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one (CID 102373494) is trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one.
What is the SMILES notation for trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one?
The canonical SMILES for trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one is C=CC[C@@H]1CCC[C@@](O)(CC=C)C1=O.
What is the InChIKey of trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one?
The InChIKey is LCWXKYZWXFBBIT-PWSUYJOCSA-N. The full InChI is InChI=1S/C12H18O2/c1-3-6-10-7-5-9-12(14,8-4-2)11(10)13/h3-4,10,14H,1-2,5-9H2/t10-,12+/m1/s1.
What are the key properties of trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one?
trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one has a molecular weight of 194.27 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2R,6S)-2-hydroxy-2,6-bis(prop-2-enyl)cyclohexan-1-one is sourced from PubChem (CID 102373494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).