About potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate
potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate (PubChem CID 102373570) has the molecular formula C17H30KNO5
and a molecular weight of 367.53 g/mol. Its IUPAC name is potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate.
Molecular Properties
| Compound Name | potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate |
| PubChem CID | 102373570 |
| Molecular Formula | C17H30KNO5 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate |
| SMILES | CCCCCCCCCCC/C([O-])=N/[C@@H](CCC(=O)O)C(=O)O.[K+] |
| InChI | InChI=1S/C17H31NO5.K/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21;/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23);/q;+1/p-1/t14-;/m0./s1 |
| InChIKey | WNEHWYCWKDNRFW-UQKRIMTDSA-M |
| XLogP | -0.01 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate?
The IUPAC name of potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate (CID 102373570) is potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate.
What is the SMILES notation for potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate?
The canonical SMILES for potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate is CCCCCCCCCCC/C([O-])=N/[C@@H](CCC(=O)O)C(=O)O.[K+].
What is the InChIKey of potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate?
The InChIKey is WNEHWYCWKDNRFW-UQKRIMTDSA-M. The full InChI is InChI=1S/C17H31NO5.K/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21;/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23);/q;+1/p-1/t14-;/m0./s1.
What are the key properties of potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate?
potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate has a molecular weight of 367.53 g/mol, XLogP of -0.01, 15 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium N-[(1S)-1,3-dicarboxypropyl]dodecanimidate is sourced from PubChem (CID 102373570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).