C23H28N2O3 — CID 10237363
3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoic acid (PubChem CID 10237363) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoic acid.
| Compound Name | 3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoic acid |
|---|---|
| PubChem CID | 10237363 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoic acid |
| SMILES | C=CCN1C[C@H](C)N([C@@H](c2cccc(O)c2)c2cccc(C(=O)O)c2)C[C@H]1C |
| InChI | InChI=1S/C23H28N2O3/c1-4-11-24-14-17(3)25(15-16(24)2)22(19-8-6-10-21(26)13-19)18-7-5-9-20(12-18)23(27)28/h4-10,12-13,16-17,22,26H,1,11,14-15H2,2-3H3,(H,27,28)/t16-,17+,22-/m1/s1 |
| InChIKey | SAYITEQGBVLQFI-HYFFOGBASA-N |
| XLogP | 3.76 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|