C18H24N2O4 — CID 102373895
methyl 5-[(3aR,6R,6aS)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl]-2-prop-2-enyl-2H-pyridine-1-carboxylate (PubChem CID 102373895) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 5-[(3aR,6R,6aS)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl]-2-prop-2-enyl-2H-pyridine-1-carboxylate.
| Compound Name | methyl 5-[(3aR,6R,6aS)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl]-2-prop-2-enyl-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 102373895 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | methyl 5-[(3aR,6R,6aS)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl]-2-prop-2-enyl-2H-pyridine-1-carboxylate |
| SMILES | C=CCC1C=CC(C(=O)N2CC[C@H]3CC[C@@H](O)[C@H]32)=CN1C(=O)OC |
| InChI | InChI=1S/C18H24N2O4/c1-3-4-14-7-5-13(11-20(14)18(23)24-2)17(22)19-10-9-12-6-8-15(21)16(12)19/h3,5,7,11-12,14-16,21H,1,4,6,8-10H2,2H3/t12-,14?,15-,16+/m1/s1 |
| InChIKey | RKJNXHYRIIJNMS-OHRKKDJYSA-N |
| XLogP | 1.83 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|