About 2-(ethylamino)cyclohepta-2,4,6-trien-1-one
2-(ethylamino)cyclohepta-2,4,6-trien-1-one (PubChem CID 102374135) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-(ethylamino)cyclohepta-2,4,6-trien-1-one.
Molecular Properties
| Compound Name | 2-(ethylamino)cyclohepta-2,4,6-trien-1-one |
| PubChem CID | 102374135 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2-(ethylamino)cyclohepta-2,4,6-trien-1-one |
| SMILES | CCNc1cccccc1=O |
| InChI | InChI=1S/C9H11NO/c1-2-10-8-6-4-3-5-7-9(8)11/h3-7H,2H2,1H3,(H,10,11) |
| InChIKey | NZBPTXWELXVAQN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(ethylamino)cyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)cyclohepta-2,4,6-trien-1-one?
The IUPAC name of 2-(ethylamino)cyclohepta-2,4,6-trien-1-one (CID 102374135) is 2-(ethylamino)cyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 2-(ethylamino)cyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 2-(ethylamino)cyclohepta-2,4,6-trien-1-one is CCNc1cccccc1=O.
What is the InChIKey of 2-(ethylamino)cyclohepta-2,4,6-trien-1-one?
The InChIKey is NZBPTXWELXVAQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-2-10-8-6-4-3-5-7-9(8)11/h3-7H,2H2,1H3,(H,10,11).
What are the key properties of 2-(ethylamino)cyclohepta-2,4,6-trien-1-one?
2-(ethylamino)cyclohepta-2,4,6-trien-1-one has a molecular weight of 149.19 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)cyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 102374135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).