C31H54O5Si2 — CID 102374520
(3Z,6S,7S,8Z,10Z,13R,15R)-7,13-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-16-oxabicyclo[13.2.2]nonadeca-3,8,10-triene-17,18-dione (PubChem CID 102374520) has the molecular formula C31H54O5Si2 and a molecular weight of 562.94 g/mol. Its IUPAC name is (3Z,6S,7S,8Z,10Z,13R,15R)-7,13-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-16-oxabicyclo[13.2.2]nonadeca-3,8,10-triene-17,18-dione.
| Compound Name | (3Z,6S,7S,8Z,10Z,13R,15R)-7,13-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-16-oxabicyclo[13.2.2]nonadeca-3,8,10-triene-17,18-dione |
|---|---|
| PubChem CID | 102374520 |
| Molecular Formula | C31H54O5Si2 |
| Molecular Weight | 562.94 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | (3Z,6S,7S,8Z,10Z,13R,15R)-7,13-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-16-oxabicyclo[13.2.2]nonadeca-3,8,10-triene-17,18-dione |
| SMILES | C[C@H]1C/C=C\CC2C(=O)C[C@@H](C[C@H](O[Si](C)(C)C(C)(C)C)C/C=C\C=C/[C@H]1O[Si](C)(C)C(C)(C)C)OC2=O |
| InChI | InChI=1S/C31H54O5Si2/c1-23-17-15-16-19-26-27(32)22-25(34-29(26)33)21-24(35-37(8,9)30(2,3)4)18-13-12-14-20-28(23)36-38(10,11)31(5,6)7/h12-16,20,23-26,28H,17-19,21-22H2,1-11H3/b13-12-,16-15-,20-14-/t23-,24+,25+,26?,28+/m0/s1 |
| InChIKey | JJOUUUQVZZKBNH-QJEJLCJJSA-N |
| XLogP | 8.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.94 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|