C12H19N3O4S — CID 102374658
N-cyclohexyl-N-[(2,4-dioxopyrimidin-1-yl)methyl]methanesulfonamide (PubChem CID 102374658) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-cyclohexyl-N-[(2,4-dioxopyrimidin-1-yl)methyl]methanesulfonamide.
| Compound Name | N-cyclohexyl-N-[(2,4-dioxopyrimidin-1-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 102374658 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-cyclohexyl-N-[(2,4-dioxopyrimidin-1-yl)methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cn1ccc(=O)[nH]c1=O)C1CCCCC1 |
| InChI | InChI=1S/C12H19N3O4S/c1-20(18,19)15(10-5-3-2-4-6-10)9-14-8-7-11(16)13-12(14)17/h7-8,10H,2-6,9H2,1H3,(H,13,16,17) |
| InChIKey | ZIRSGAUHQGZEES-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |