C23H46O2Si — CID 102374991
tri(propan-2-yl)-[(2S,3R)-2,6,6-trimethyl-2-(4-methylpent-3-enyl)oxan-3-yl]oxysilane (PubChem CID 102374991) has the molecular formula C23H46O2Si and a molecular weight of 382.71 g/mol. Its IUPAC name is tri(propan-2-yl)-[(2S,3R)-2,6,6-trimethyl-2-(4-methylpent-3-enyl)oxan-3-yl]oxysilane.
| Compound Name | tri(propan-2-yl)-[(2S,3R)-2,6,6-trimethyl-2-(4-methylpent-3-enyl)oxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 102374991 |
| Molecular Formula | C23H46O2Si |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | tri(propan-2-yl)-[(2S,3R)-2,6,6-trimethyl-2-(4-methylpent-3-enyl)oxan-3-yl]oxysilane |
| SMILES | CC(C)=CCC[C@]1(C)OC(C)(C)CC[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H46O2Si/c1-17(2)13-12-15-23(11)21(14-16-22(9,10)25-23)24-26(18(3)4,19(5)6)20(7)8/h13,18-21H,12,14-16H2,1-11H3/t21-,23+/m1/s1 |
| InChIKey | MTGFKNPVTFKFCD-GGAORHGYSA-N |
| XLogP | 7.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|