C21H26NO2P — CID 102375409
3-benzhydryl-2-[(2R)-2-methylbut-3-enyl]-1,3,2λ5-oxazaphosphinane 2-oxide (PubChem CID 102375409) has the molecular formula C21H26NO2P and a molecular weight of 355.42 g/mol. Its IUPAC name is 3-benzhydryl-2-[(2R)-2-methylbut-3-enyl]-1,3,2λ5-oxazaphosphinane 2-oxide.
| Compound Name | 3-benzhydryl-2-[(2R)-2-methylbut-3-enyl]-1,3,2λ5-oxazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 102375409 |
| Molecular Formula | C21H26NO2P |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-benzhydryl-2-[(2R)-2-methylbut-3-enyl]-1,3,2λ5-oxazaphosphinane 2-oxide |
| SMILES | C=C[C@@H](C)CP1(=O)OCCCN1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26NO2P/c1-3-18(2)17-25(23)22(15-10-16-24-25)21(19-11-6-4-7-12-19)20-13-8-5-9-14-20/h3-9,11-14,18,21H,1,10,15-17H2,2H3/t18-,25?/m1/s1 |
| InChIKey | BVVDZGFTTFNXPO-YDONVPIESA-N |
| XLogP | 5.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|