About (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole
(2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole (PubChem CID 102375989) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole |
| PubChem CID | 102375989 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole |
| SMILES | COC1=CCN[C@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H15NO/c1-17-14-8-9-16-15(14)13-7-6-11-4-2-3-5-12(11)10-13/h2-8,10,15-16H,9H2,1H3/t15-/m0/s1 |
| InChIKey | CIVGIGZYNQHYDR-HNNXBMFYSA-N |
| XLogP | 3.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole?
The IUPAC name of (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole (CID 102375989) is (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole.
What is the SMILES notation for (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole?
The canonical SMILES for (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole is COC1=CCN[C@H]1c1ccc2ccccc2c1.
What is the InChIKey of (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole?
The InChIKey is CIVGIGZYNQHYDR-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H15NO/c1-17-14-8-9-16-15(14)13-7-6-11-4-2-3-5-12(11)10-13/h2-8,10,15-16H,9H2,1H3/t15-/m0/s1.
What are the key properties of (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole?
(2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole has a molecular weight of 225.29 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-methoxy-2-naphthalen-2-yl-2,5-dihydro-1H-pyrrole is sourced from PubChem (CID 102375989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).