C32H50O12 — CID 102376072
(1S,2S)-2-[[2-[[(1S,2S)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]methyl]phenyl]methoxy]-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 102376072) has the molecular formula C32H50O12 and a molecular weight of 626.74 g/mol. Its IUPAC name is (1S,2S)-2-[[2-[[(1S,2S)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]methyl]phenyl]methoxy]-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (1S,2S)-2-[[2-[[(1S,2S)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]methyl]phenyl]methoxy]-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 102376072 |
| Molecular Formula | C32H50O12 |
| Molecular Weight | 626.74 g/mol |
| Exact Mass | 626.33 |
| IUPAC Name | (1S,2S)-2-[[2-[[(1S,2S)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]methyl]phenyl]methoxy]-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | CC1(C)OC[C@H]([C@H](O)[C@H](OCc2ccccc2CO[C@@H]([C@@H](O)[C@H]2COC(C)(C)O2)[C@H]2COC(C)(C)O2)[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C32H50O12/c1-29(2)37-15-21(41-29)25(33)27(23-17-39-31(5,6)43-23)35-13-19-11-9-10-12-20(19)14-36-28(24-18-40-32(7,8)44-24)26(34)22-16-38-30(3,4)42-22/h9-12,21-28,33-34H,13-18H2,1-8H3/t21-,22-,23-,24-,25+,26+,27-,28-/m1/s1 |
| InChIKey | XYNCLIULNONEEF-UVOVEWRNSA-N |
| XLogP | 2.78 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.74 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |