About 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline
6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline (PubChem CID 1023763) has the molecular formula C26H27NO4
and a molecular weight of 417.51 g/mol. Its IUPAC name is 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline |
| PubChem CID | 1023763 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc(OCc3ccccc3)c(OC)c1)=NCC2 |
| InChI | InChI=1S/C26H27NO4/c1-28-24-14-19(9-10-23(24)31-17-18-7-5-4-6-8-18)13-22-21-16-26(30-3)25(29-2)15-20(21)11-12-27-22/h4-10,14-16H,11-13,17H2,1-3H3 |
| InChIKey | YPDPXLXQZBEHOG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline?
The IUPAC name of 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline (CID 1023763) is 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline.
What is the SMILES notation for 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline?
The canonical SMILES for 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline is COc1cc2c(cc1OC)C(Cc1ccc(OCc3ccccc3)c(OC)c1)=NCC2.
What is the InChIKey of 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline?
The InChIKey is YPDPXLXQZBEHOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27NO4/c1-28-24-14-19(9-10-23(24)31-17-18-7-5-4-6-8-18)13-22-21-16-26(30-3)25(29-2)15-20(21)11-12-27-22/h4-10,14-16H,11-13,17H2,1-3H3.
What are the key properties of 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline?
6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline has a molecular weight of 417.51 g/mol, XLogP of 4.88, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline is sourced from PubChem (CID 1023763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).