C6H12N4O — CID 102376399
2-N-butyl-1,3,4-oxadiazole-2,5-diamine (PubChem CID 102376399) has the molecular formula C6H12N4O and a molecular weight of 156.19 g/mol. Its IUPAC name is 2-N-butyl-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-butyl-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 102376399 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 2-N-butyl-1,3,4-oxadiazole-2,5-diamine |
| SMILES | CCCCNc1nnc(N)o1 |
| InChI | InChI=1S/C6H12N4O/c1-2-3-4-8-6-10-9-5(7)11-6/h2-4H2,1H3,(H2,7,9)(H,8,10) |
| InChIKey | OGZKQHLDLCGPAZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|