About butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate
butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate (PubChem CID 102376400) has the molecular formula C12H18N4OS
and a molecular weight of 266.37 g/mol. Its IUPAC name is butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate.
Molecular Properties
| Compound Name | butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate |
| PubChem CID | 102376400 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate |
| SMILES | CCCCS/C(=N\c1ccccc1)NNC(N)=O |
| InChI | InChI=1S/C12H18N4OS/c1-2-3-9-18-12(16-15-11(13)17)14-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H,14,16)(H3,13,15,17) |
| InChIKey | DPHWEFJIJKYZKA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate?
The IUPAC name of butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate (CID 102376400) is butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate.
What is the SMILES notation for butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate?
The canonical SMILES for butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate is CCCCS/C(=N\c1ccccc1)NNC(N)=O.
What is the InChIKey of butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate?
The InChIKey is DPHWEFJIJKYZKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4OS/c1-2-3-9-18-12(16-15-11(13)17)14-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H,14,16)(H3,13,15,17).
What are the key properties of butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate?
butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate has a molecular weight of 266.37 g/mol, XLogP of 2.38, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-(carbamoylamino)-N'-phenylcarbamimidothioate is sourced from PubChem (CID 102376400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).